C18H12N4 — CID 168607446
2-[4-(2-methylphenyl)anilino]ethene-1,1,2-tricarbonitrile (PubChem CID 168607446) has the molecular formula C18H12N4 and a molecular weight of 284.32 g/mol. Its IUPAC name is 2-[4-(2-methylphenyl)anilino]ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-[4-(2-methylphenyl)anilino]ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168607446 |
| Molecular Formula | C18H12N4 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 2-[4-(2-methylphenyl)anilino]ethene-1,1,2-tricarbonitrile |
| SMILES | Cc1ccccc1-c1ccc(NC(C#N)=C(C#N)C#N)cc1 |
| InChI | InChI=1S/C18H12N4/c1-13-4-2-3-5-17(13)14-6-8-16(9-7-14)22-18(12-21)15(10-19)11-20/h2-9,22H,1H3 |
| InChIKey | HXSQQMQGLVOIML-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|