C19H9N5O2 — CID 168608169
2-[4-(1,3-dioxoisoindol-2-yl)anilino]ethene-1,1,2-tricarbonitrile (PubChem CID 168608169) has the molecular formula C19H9N5O2 and a molecular weight of 339.31 g/mol. Its IUPAC name is 2-[4-(1,3-dioxoisoindol-2-yl)anilino]ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-[4-(1,3-dioxoisoindol-2-yl)anilino]ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168608169 |
| Molecular Formula | C19H9N5O2 |
| Molecular Weight | 339.31 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | 2-[4-(1,3-dioxoisoindol-2-yl)anilino]ethene-1,1,2-tricarbonitrile |
| SMILES | N#CC(C#N)=C(C#N)Nc1ccc(N2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C19H9N5O2/c20-9-12(10-21)17(11-22)23-13-5-7-14(8-6-13)24-18(25)15-3-1-2-4-16(15)19(24)26/h1-8,23H |
| InChIKey | VZJQTTFUHMKJDY-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 120.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.31 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|