C19H13N5O — CID 168608026
N-(4-methylphenyl)-3-(1,2,2-tricyanoethenylamino)benzamide (PubChem CID 168608026) has the molecular formula C19H13N5O and a molecular weight of 327.35 g/mol. Its IUPAC name is N-(4-methylphenyl)-3-(1,2,2-tricyanoethenylamino)benzamide.
| Compound Name | N-(4-methylphenyl)-3-(1,2,2-tricyanoethenylamino)benzamide |
|---|---|
| PubChem CID | 168608026 |
| Molecular Formula | C19H13N5O |
| Molecular Weight | 327.35 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | N-(4-methylphenyl)-3-(1,2,2-tricyanoethenylamino)benzamide |
| SMILES | Cc1ccc(NC(=O)c2cccc(NC(C#N)=C(C#N)C#N)c2)cc1 |
| InChI | InChI=1S/C19H13N5O/c1-13-5-7-16(8-6-13)24-19(25)14-3-2-4-17(9-14)23-18(12-22)15(10-20)11-21/h2-9,23H,1H3,(H,24,25) |
| InChIKey | ISHBDMKHCFRQMM-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 112.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.35 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|