C19H13N5O2 — CID 168606757
N-(4-methoxyphenyl)-3-(1,2,2-tricyanoethenylamino)benzamide (PubChem CID 168606757) has the molecular formula C19H13N5O2 and a molecular weight of 343.35 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-3-(1,2,2-tricyanoethenylamino)benzamide.
| Compound Name | N-(4-methoxyphenyl)-3-(1,2,2-tricyanoethenylamino)benzamide |
|---|---|
| PubChem CID | 168606757 |
| Molecular Formula | C19H13N5O2 |
| Molecular Weight | 343.35 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | N-(4-methoxyphenyl)-3-(1,2,2-tricyanoethenylamino)benzamide |
| SMILES | COc1ccc(NC(=O)c2cccc(NC(C#N)=C(C#N)C#N)c2)cc1 |
| InChI | InChI=1S/C19H13N5O2/c1-26-17-7-5-15(6-8-17)24-19(25)13-3-2-4-16(9-13)23-18(12-22)14(10-20)11-21/h2-9,23H,1H3,(H,24,25) |
| InChIKey | JASXOOXODGHIRV-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 121.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.35 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|