C25H16N6O2 — CID 168609387
1-N,3-N-diphenyl-5-(1,2,2-tricyanoethenylamino)benzene-1,3-dicarboxamide (PubChem CID 168609387) has the molecular formula C25H16N6O2 and a molecular weight of 432.44 g/mol. Its IUPAC name is 1-N,3-N-diphenyl-5-(1,2,2-tricyanoethenylamino)benzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-diphenyl-5-(1,2,2-tricyanoethenylamino)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 168609387 |
| Molecular Formula | C25H16N6O2 |
| Molecular Weight | 432.44 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | 1-N,3-N-diphenyl-5-(1,2,2-tricyanoethenylamino)benzene-1,3-dicarboxamide |
| SMILES | N#CC(C#N)=C(C#N)Nc1cc(C(=O)Nc2ccccc2)cc(C(=O)Nc2ccccc2)c1 |
| InChI | InChI=1S/C25H16N6O2/c26-14-19(15-27)23(16-28)29-22-12-17(24(32)30-20-7-3-1-4-8-20)11-18(13-22)25(33)31-21-9-5-2-6-10-21/h1-13,29H,(H,30,32)(H,31,33) |
| InChIKey | KAPMPVQSWGFLJH-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 141.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.44 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|