C12H5BrN4O2 — CID 168606279
3-bromo-5-(1,2,2-tricyanoethenylamino)benzoic acid (PubChem CID 168606279) has the molecular formula C12H5BrN4O2 and a molecular weight of 317.10 g/mol. Its IUPAC name is 3-bromo-5-(1,2,2-tricyanoethenylamino)benzoic acid.
| Compound Name | 3-bromo-5-(1,2,2-tricyanoethenylamino)benzoic acid |
|---|---|
| PubChem CID | 168606279 |
| Molecular Formula | C12H5BrN4O2 |
| Molecular Weight | 317.10 g/mol |
| Exact Mass | 315.96 |
| IUPAC Name | 3-bromo-5-(1,2,2-tricyanoethenylamino)benzoic acid |
| SMILES | N#CC(C#N)=C(C#N)Nc1cc(Br)cc(C(=O)O)c1 |
| InChI | InChI=1S/C12H5BrN4O2/c13-9-1-7(12(18)19)2-10(3-9)17-11(6-16)8(4-14)5-15/h1-3,17H,(H,18,19) |
| InChIKey | JQMDGXVGRWRSTO-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 120.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.10 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|