3-bromo-5-(1,2,2-tricyanoethenylamino)benzoic acid

C12H5BrN4O2 — CID 168606279

IUPAC3-bromo-5-(1,2,2-tricyanoethenylamino)benzoic acid
SMILESN#CC(C#N)=C(C#N)Nc1cc(Br)cc(C(=O)O)c1
InChIInChI=1S/C12H5BrN4O2/c13-9-1-7(12(18)19)2-10(3-9)17-11(6-16)8(4-14)5-15/h1-3,17H,(H,18,19)
InChIKeyJQMDGXVGRWRSTO-UHFFFAOYSA-N
MW317.10 g/mol
LogP2.38
Rot. Bonds3

About 3-bromo-5-(1,2,2-tricyanoethenylamino)benzoic acid

3-bromo-5-(1,2,2-tricyanoethenylamino)benzoic acid (PubChem CID 168606279) has the molecular formula C12H5BrN4O2 and a molecular weight of 317.10 g/mol. Its IUPAC name is 3-bromo-5-(1,2,2-tricyanoethenylamino)benzoic acid.

Molecular Properties

Compound Name3-bromo-5-(1,2,2-tricyanoethenylamino)benzoic acid
PubChem CID168606279
Molecular FormulaC12H5BrN4O2
Molecular Weight317.10 g/mol
Exact Mass315.96
IUPAC Name3-bromo-5-(1,2,2-tricyanoethenylamino)benzoic acid
SMILESN#CC(C#N)=C(C#N)Nc1cc(Br)cc(C(=O)O)c1
InChIInChI=1S/C12H5BrN4O2/c13-9-1-7(12(18)19)2-10(3-9)17-11(6-16)8(4-14)5-15/h1-3,17H,(H,18,19)
InChIKeyJQMDGXVGRWRSTO-UHFFFAOYSA-N
XLogP2.38
TPSA120.70 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500317.10
LogP ≤ 52.38
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}

Analyze 3-bromo-5-(1,2,2-tricyanoethenylamino)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-bromo-5-(1,2,2-tricyanoethenylamino)benzoic acid?
The IUPAC name of 3-bromo-5-(1,2,2-tricyanoethenylamino)benzoic acid (CID 168606279) is 3-bromo-5-(1,2,2-tricyanoethenylamino)benzoic acid.
What is the SMILES notation for 3-bromo-5-(1,2,2-tricyanoethenylamino)benzoic acid?
The canonical SMILES for 3-bromo-5-(1,2,2-tricyanoethenylamino)benzoic acid is N#CC(C#N)=C(C#N)Nc1cc(Br)cc(C(=O)O)c1.
What is the InChIKey of 3-bromo-5-(1,2,2-tricyanoethenylamino)benzoic acid?
The InChIKey is JQMDGXVGRWRSTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H5BrN4O2/c13-9-1-7(12(18)19)2-10(3-9)17-11(6-16)8(4-14)5-15/h1-3,17H,(H,18,19).
What are the key properties of 3-bromo-5-(1,2,2-tricyanoethenylamino)benzoic acid?
3-bromo-5-(1,2,2-tricyanoethenylamino)benzoic acid has a molecular weight of 317.10 g/mol, XLogP of 2.38, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-5-(1,2,2-tricyanoethenylamino)benzoic acid is sourced from PubChem (CID 168606279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).