C13H6F3N5OS — CID 168609388
3-(1,2,2-tricyanoethenylamino)-5-(trifluoromethylsulfanyl)benzamide (PubChem CID 168609388) has the molecular formula C13H6F3N5OS and a molecular weight of 337.29 g/mol. Its IUPAC name is 3-(1,2,2-tricyanoethenylamino)-5-(trifluoromethylsulfanyl)benzamide.
| Compound Name | 3-(1,2,2-tricyanoethenylamino)-5-(trifluoromethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 168609388 |
| Molecular Formula | C13H6F3N5OS |
| Molecular Weight | 337.29 g/mol |
| Exact Mass | 337.02 |
| IUPAC Name | 3-(1,2,2-tricyanoethenylamino)-5-(trifluoromethylsulfanyl)benzamide |
| SMILES | N#CC(C#N)=C(C#N)Nc1cc(SC(F)(F)F)cc(C(N)=O)c1 |
| InChI | InChI=1S/C13H6F3N5OS/c14-13(15,16)23-10-2-7(12(20)22)1-9(3-10)21-11(6-19)8(4-17)5-18/h1-3,21H,(H2,20,22) |
| InChIKey | AHERHUSVDVGKGQ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 126.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.29 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|