C11H6N4O2 — CID 168609923
2-(3,5-dihydroxyanilino)ethene-1,1,2-tricarbonitrile (PubChem CID 168609923) has the molecular formula C11H6N4O2 and a molecular weight of 226.19 g/mol. Its IUPAC name is 2-(3,5-dihydroxyanilino)ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-(3,5-dihydroxyanilino)ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168609923 |
| Molecular Formula | C11H6N4O2 |
| Molecular Weight | 226.19 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | 2-(3,5-dihydroxyanilino)ethene-1,1,2-tricarbonitrile |
| SMILES | N#CC(C#N)=C(C#N)Nc1cc(O)cc(O)c1 |
| InChI | InChI=1S/C11H6N4O2/c12-4-7(5-13)11(6-14)15-8-1-9(16)3-10(17)2-8/h1-3,15-17H |
| InChIKey | AIUPMEWBKRIMEF-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 123.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.19 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|