C11H4BrFN4 — CID 168600572
2-(3-bromo-4-fluoroanilino)ethene-1,1,2-tricarbonitrile (PubChem CID 168600572) has the molecular formula C11H4BrFN4 and a molecular weight of 291.08 g/mol. Its IUPAC name is 2-(3-bromo-4-fluoroanilino)ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-(3-bromo-4-fluoroanilino)ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168600572 |
| Molecular Formula | C11H4BrFN4 |
| Molecular Weight | 291.08 g/mol |
| Exact Mass | 289.96 |
| IUPAC Name | 2-(3-bromo-4-fluoroanilino)ethene-1,1,2-tricarbonitrile |
| SMILES | N#CC(C#N)=C(C#N)Nc1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C11H4BrFN4/c12-9-3-8(1-2-10(9)13)17-11(6-16)7(4-14)5-15/h1-3,17H |
| InChIKey | YXQRSPMGILYMKQ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.08 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|