C12H4FN5 — CID 168610628
2-(3-cyano-4-fluoroanilino)ethene-1,1,2-tricarbonitrile (PubChem CID 168610628) has the molecular formula C12H4FN5 and a molecular weight of 237.20 g/mol. Its IUPAC name is 2-(3-cyano-4-fluoroanilino)ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-(3-cyano-4-fluoroanilino)ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168610628 |
| Molecular Formula | C12H4FN5 |
| Molecular Weight | 237.20 g/mol |
| Exact Mass | 237.05 |
| IUPAC Name | 2-(3-cyano-4-fluoroanilino)ethene-1,1,2-tricarbonitrile |
| SMILES | N#CC(C#N)=C(C#N)Nc1ccc(F)c(C#N)c1 |
| InChI | InChI=1S/C12H4FN5/c13-11-2-1-10(3-8(11)4-14)18-12(7-17)9(5-15)6-16/h1-3,18H |
| InChIKey | JPYUHNCKNLHNDA-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 107.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.20 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|