C11H12FN3S — CID 115609909
1-(3-cyano-4-fluorophenyl)-3-propan-2-ylthiourea (PubChem CID 115609909) has the molecular formula C11H12FN3S and a molecular weight of 237.30 g/mol. Its IUPAC name is 1-(3-cyano-4-fluorophenyl)-3-propan-2-ylthiourea.
| Compound Name | 1-(3-cyano-4-fluorophenyl)-3-propan-2-ylthiourea |
|---|---|
| PubChem CID | 115609909 |
| Molecular Formula | C11H12FN3S |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | 1-(3-cyano-4-fluorophenyl)-3-propan-2-ylthiourea |
| SMILES | CC(C)NC(=S)Nc1ccc(F)c(C#N)c1 |
| InChI | InChI=1S/C11H12FN3S/c1-7(2)14-11(16)15-9-3-4-10(12)8(5-9)6-13/h3-5,7H,1-2H3,(H2,14,15,16) |
| InChIKey | HTEYVLGGMATKKI-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 47.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|