C16H12N4O2 — CID 168610430
prop-2-enyl 3-methyl-5-(1,2,2-tricyanoethenylamino)benzoate (PubChem CID 168610430) has the molecular formula C16H12N4O2 and a molecular weight of 292.30 g/mol. Its IUPAC name is prop-2-enyl 3-methyl-5-(1,2,2-tricyanoethenylamino)benzoate.
| Compound Name | prop-2-enyl 3-methyl-5-(1,2,2-tricyanoethenylamino)benzoate |
|---|---|
| PubChem CID | 168610430 |
| Molecular Formula | C16H12N4O2 |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | prop-2-enyl 3-methyl-5-(1,2,2-tricyanoethenylamino)benzoate |
| SMILES | C=CCOC(=O)c1cc(C)cc(NC(C#N)=C(C#N)C#N)c1 |
| InChI | InChI=1S/C16H12N4O2/c1-3-4-22-16(21)12-5-11(2)6-14(7-12)20-15(10-19)13(8-17)9-18/h3,5-7,20H,1,4H2,2H3 |
| InChIKey | WQVIAESCKZBVGM-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 109.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|