About prop-2-enyl 3-methyl-5-nitrobenzoate
prop-2-enyl 3-methyl-5-nitrobenzoate (PubChem CID 22168557) has the molecular formula C11H11NO4
and a molecular weight of 221.21 g/mol. Its IUPAC name is prop-2-enyl 3-methyl-5-nitrobenzoate.
Molecular Properties
| Compound Name | prop-2-enyl 3-methyl-5-nitrobenzoate |
| PubChem CID | 22168557 |
| Molecular Formula | C11H11NO4 |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | prop-2-enyl 3-methyl-5-nitrobenzoate |
| SMILES | C=CCOC(=O)c1cc(C)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H11NO4/c1-3-4-16-11(13)9-5-8(2)6-10(7-9)12(14)15/h3,5-7H,1,4H2,2H3 |
| InChIKey | QXYKFLCUGMOBKJ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl 3-methyl-5-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl 3-methyl-5-nitrobenzoate?
The IUPAC name of prop-2-enyl 3-methyl-5-nitrobenzoate (CID 22168557) is prop-2-enyl 3-methyl-5-nitrobenzoate.
What is the SMILES notation for prop-2-enyl 3-methyl-5-nitrobenzoate?
The canonical SMILES for prop-2-enyl 3-methyl-5-nitrobenzoate is C=CCOC(=O)c1cc(C)cc([N+](=O)[O-])c1.
What is the InChIKey of prop-2-enyl 3-methyl-5-nitrobenzoate?
The InChIKey is QXYKFLCUGMOBKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO4/c1-3-4-16-11(13)9-5-8(2)6-10(7-9)12(14)15/h3,5-7H,1,4H2,2H3.
What are the key properties of prop-2-enyl 3-methyl-5-nitrobenzoate?
prop-2-enyl 3-methyl-5-nitrobenzoate has a molecular weight of 221.21 g/mol, XLogP of 2.25, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl 3-methyl-5-nitrobenzoate is sourced from PubChem (CID 22168557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).