C16H14N4O2 — CID 168606601
tert-butyl 3-(1,2,2-tricyanoethenylamino)benzoate (PubChem CID 168606601) has the molecular formula C16H14N4O2 and a molecular weight of 294.31 g/mol. Its IUPAC name is tert-butyl 3-(1,2,2-tricyanoethenylamino)benzoate.
| Compound Name | tert-butyl 3-(1,2,2-tricyanoethenylamino)benzoate |
|---|---|
| PubChem CID | 168606601 |
| Molecular Formula | C16H14N4O2 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | tert-butyl 3-(1,2,2-tricyanoethenylamino)benzoate |
| SMILES | CC(C)(C)OC(=O)c1cccc(NC(C#N)=C(C#N)C#N)c1 |
| InChI | InChI=1S/C16H14N4O2/c1-16(2,3)22-15(21)11-5-4-6-13(7-11)20-14(10-19)12(8-17)9-18/h4-7,20H,1-3H3 |
| InChIKey | XYTZIOKHCXQUHF-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 109.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|