C20H15N5O3 — CID 168610870
N-(2,5-dimethoxyphenyl)-3-(1,2,2-tricyanoethenylamino)benzamide (PubChem CID 168610870) has the molecular formula C20H15N5O3 and a molecular weight of 373.37 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-3-(1,2,2-tricyanoethenylamino)benzamide.
| Compound Name | N-(2,5-dimethoxyphenyl)-3-(1,2,2-tricyanoethenylamino)benzamide |
|---|---|
| PubChem CID | 168610870 |
| Molecular Formula | C20H15N5O3 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-3-(1,2,2-tricyanoethenylamino)benzamide |
| SMILES | COc1ccc(OC)c(NC(=O)c2cccc(NC(C#N)=C(C#N)C#N)c2)c1 |
| InChI | InChI=1S/C20H15N5O3/c1-27-16-6-7-19(28-2)17(9-16)25-20(26)13-4-3-5-15(8-13)24-18(12-23)14(10-21)11-22/h3-9,24H,1-2H3,(H,25,26) |
| InChIKey | HZMGDPDZWAKBJG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 130.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|