C12H4Br2N4O2 — CID 168610511
3,5-dibromo-2-(1,2,2-tricyanoethenylamino)benzoic acid (PubChem CID 168610511) has the molecular formula C12H4Br2N4O2 and a molecular weight of 396.00 g/mol. Its IUPAC name is 3,5-dibromo-2-(1,2,2-tricyanoethenylamino)benzoic acid.
| Compound Name | 3,5-dibromo-2-(1,2,2-tricyanoethenylamino)benzoic acid |
|---|---|
| PubChem CID | 168610511 |
| Molecular Formula | C12H4Br2N4O2 |
| Molecular Weight | 396.00 g/mol |
| Exact Mass | 393.87 |
| IUPAC Name | 3,5-dibromo-2-(1,2,2-tricyanoethenylamino)benzoic acid |
| SMILES | N#CC(C#N)=C(C#N)Nc1c(Br)cc(Br)cc1C(=O)O |
| InChI | InChI=1S/C12H4Br2N4O2/c13-7-1-8(12(19)20)11(9(14)2-7)18-10(5-17)6(3-15)4-16/h1-2,18H,(H,19,20) |
| InChIKey | DXIVHBMYBMTHPN-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 120.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.00 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|