C11H11Br2NO3S — CID 55176918
3,5-dibromo-2-(3-methylsulfanylpropanoylamino)benzoic acid (PubChem CID 55176918) has the molecular formula C11H11Br2NO3S and a molecular weight of 397.09 g/mol. Its IUPAC name is 3,5-dibromo-2-(3-methylsulfanylpropanoylamino)benzoic acid.
| Compound Name | 3,5-dibromo-2-(3-methylsulfanylpropanoylamino)benzoic acid |
|---|---|
| PubChem CID | 55176918 |
| Molecular Formula | C11H11Br2NO3S |
| Molecular Weight | 397.09 g/mol |
| Exact Mass | 394.88 |
| IUPAC Name | 3,5-dibromo-2-(3-methylsulfanylpropanoylamino)benzoic acid |
| SMILES | CSCCC(=O)Nc1c(Br)cc(Br)cc1C(=O)O |
| InChI | InChI=1S/C11H11Br2NO3S/c1-18-3-2-9(15)14-10-7(11(16)17)4-6(12)5-8(10)13/h4-5H,2-3H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | OCOGXVMTZUQGEZ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.09 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |