C12H13Br2N3O4 — CID 63112309
3,5-dibromo-2-[[2-(ethylamino)-2-oxoethyl]carbamoylamino]benzoic acid (PubChem CID 63112309) has the molecular formula C12H13Br2N3O4 and a molecular weight of 423.06 g/mol. Its IUPAC name is 3,5-dibromo-2-[[2-(ethylamino)-2-oxoethyl]carbamoylamino]benzoic acid.
| Compound Name | 3,5-dibromo-2-[[2-(ethylamino)-2-oxoethyl]carbamoylamino]benzoic acid |
|---|---|
| PubChem CID | 63112309 |
| Molecular Formula | C12H13Br2N3O4 |
| Molecular Weight | 423.06 g/mol |
| Exact Mass | 420.93 |
| IUPAC Name | 3,5-dibromo-2-[[2-(ethylamino)-2-oxoethyl]carbamoylamino]benzoic acid |
| SMILES | CCNC(=O)CNC(=O)Nc1c(Br)cc(Br)cc1C(=O)O |
| InChI | InChI=1S/C12H13Br2N3O4/c1-2-15-9(18)5-16-12(21)17-10-7(11(19)20)3-6(13)4-8(10)14/h3-4H,2,5H2,1H3,(H,15,18)(H,19,20)(H2,16,17,21) |
| InChIKey | XWZRAFIQPUTWPX-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.06 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |