C14H14Br2N2O3 — CID 106232388
3,5-dibromo-2-(hex-1-yn-3-ylcarbamoylamino)benzoic acid (PubChem CID 106232388) has the molecular formula C14H14Br2N2O3 and a molecular weight of 418.09 g/mol. Its IUPAC name is 3,5-dibromo-2-(hex-1-yn-3-ylcarbamoylamino)benzoic acid.
| Compound Name | 3,5-dibromo-2-(hex-1-yn-3-ylcarbamoylamino)benzoic acid |
|---|---|
| PubChem CID | 106232388 |
| Molecular Formula | C14H14Br2N2O3 |
| Molecular Weight | 418.09 g/mol |
| Exact Mass | 415.94 |
| IUPAC Name | 3,5-dibromo-2-(hex-1-yn-3-ylcarbamoylamino)benzoic acid |
| SMILES | C#CC(CCC)NC(=O)Nc1c(Br)cc(Br)cc1C(=O)O |
| InChI | InChI=1S/C14H14Br2N2O3/c1-3-5-9(4-2)17-14(21)18-12-10(13(19)20)6-8(15)7-11(12)16/h2,6-7,9H,3,5H2,1H3,(H,19,20)(H2,17,18,21) |
| InChIKey | KORNLSVPMFMVSJ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.09 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|