C11H12Br2N2O3 — CID 63112369
2-[(3-amino-2-methylpropanoyl)amino]-3,5-dibromobenzoic acid (PubChem CID 63112369) has the molecular formula C11H12Br2N2O3 and a molecular weight of 380.04 g/mol. Its IUPAC name is 2-[(3-amino-2-methylpropanoyl)amino]-3,5-dibromobenzoic acid.
| Compound Name | 2-[(3-amino-2-methylpropanoyl)amino]-3,5-dibromobenzoic acid |
|---|---|
| PubChem CID | 63112369 |
| Molecular Formula | C11H12Br2N2O3 |
| Molecular Weight | 380.04 g/mol |
| Exact Mass | 377.92 |
| IUPAC Name | 2-[(3-amino-2-methylpropanoyl)amino]-3,5-dibromobenzoic acid |
| SMILES | CC(CN)C(=O)Nc1c(Br)cc(Br)cc1C(=O)O |
| InChI | InChI=1S/C11H12Br2N2O3/c1-5(4-14)10(16)15-9-7(11(17)18)2-6(12)3-8(9)13/h2-3,5H,4,14H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | VYSKTZLIZKPFPI-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.04 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |