C10H11BrCl2N2O — CID 62671003
3-amino-N-(4-bromo-2,6-dichlorophenyl)-2-methylpropanamide (PubChem CID 62671003) has the molecular formula C10H11BrCl2N2O and a molecular weight of 326.02 g/mol. Its IUPAC name is 3-amino-N-(4-bromo-2,6-dichlorophenyl)-2-methylpropanamide.
| Compound Name | 3-amino-N-(4-bromo-2,6-dichlorophenyl)-2-methylpropanamide |
|---|---|
| PubChem CID | 62671003 |
| Molecular Formula | C10H11BrCl2N2O |
| Molecular Weight | 326.02 g/mol |
| Exact Mass | 323.94 |
| IUPAC Name | 3-amino-N-(4-bromo-2,6-dichlorophenyl)-2-methylpropanamide |
| SMILES | CC(CN)C(=O)Nc1c(Cl)cc(Br)cc1Cl |
| InChI | InChI=1S/C10H11BrCl2N2O/c1-5(4-14)10(16)15-9-7(12)2-6(11)3-8(9)13/h2-3,5H,4,14H2,1H3,(H,15,16) |
| InChIKey | OUKQZHCXXJAMCO-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.02 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |