C13H15BrCl2N2O3 — CID 61186263
2-[(4-bromo-2,6-dichlorophenyl)carbamoylamino]-4-methylpentanoic acid (PubChem CID 61186263) has the molecular formula C13H15BrCl2N2O3 and a molecular weight of 398.08 g/mol. Its IUPAC name is 2-[(4-bromo-2,6-dichlorophenyl)carbamoylamino]-4-methylpentanoic acid.
| Compound Name | 2-[(4-bromo-2,6-dichlorophenyl)carbamoylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 61186263 |
| Molecular Formula | C13H15BrCl2N2O3 |
| Molecular Weight | 398.08 g/mol |
| Exact Mass | 395.96 |
| IUPAC Name | 2-[(4-bromo-2,6-dichlorophenyl)carbamoylamino]-4-methylpentanoic acid |
| SMILES | CC(C)CC(NC(=O)Nc1c(Cl)cc(Br)cc1Cl)C(=O)O |
| InChI | InChI=1S/C13H15BrCl2N2O3/c1-6(2)3-10(12(19)20)17-13(21)18-11-8(15)4-7(14)5-9(11)16/h4-6,10H,3H2,1-2H3,(H,19,20)(H2,17,18,21) |
| InChIKey | DLDFLVFSVPMCCN-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.08 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |