C9H9BrCl2N2O — CID 116654094
3-(4-bromo-2,6-dichlorophenyl)-1,1-dimethylurea (PubChem CID 116654094) has the molecular formula C9H9BrCl2N2O and a molecular weight of 311.99 g/mol. Its IUPAC name is 3-(4-bromo-2,6-dichlorophenyl)-1,1-dimethylurea.
| Compound Name | 3-(4-bromo-2,6-dichlorophenyl)-1,1-dimethylurea |
|---|---|
| PubChem CID | 116654094 |
| Molecular Formula | C9H9BrCl2N2O |
| Molecular Weight | 311.99 g/mol |
| Exact Mass | 309.93 |
| IUPAC Name | 3-(4-bromo-2,6-dichlorophenyl)-1,1-dimethylurea |
| SMILES | CN(C)C(=O)Nc1c(Cl)cc(Br)cc1Cl |
| InChI | InChI=1S/C9H9BrCl2N2O/c1-14(2)9(15)13-8-6(11)3-5(10)4-7(8)12/h3-4H,1-2H3,(H,13,15) |
| InChIKey | WTOAFUYWFKTQNT-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.99 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |