C13H17BrCl2N2O — CID 54928480
N-(4-bromo-2,6-dichlorophenyl)-3-(tert-butylamino)propanamide (PubChem CID 54928480) has the molecular formula C13H17BrCl2N2O and a molecular weight of 368.10 g/mol. Its IUPAC name is N-(4-bromo-2,6-dichlorophenyl)-3-(tert-butylamino)propanamide.
| Compound Name | N-(4-bromo-2,6-dichlorophenyl)-3-(tert-butylamino)propanamide |
|---|---|
| PubChem CID | 54928480 |
| Molecular Formula | C13H17BrCl2N2O |
| Molecular Weight | 368.10 g/mol |
| Exact Mass | 365.99 |
| IUPAC Name | N-(4-bromo-2,6-dichlorophenyl)-3-(tert-butylamino)propanamide |
| SMILES | CC(C)(C)NCCC(=O)Nc1c(Cl)cc(Br)cc1Cl |
| InChI | InChI=1S/C13H17BrCl2N2O/c1-13(2,3)17-5-4-11(19)18-12-9(15)6-8(14)7-10(12)16/h6-7,17H,4-5H2,1-3H3,(H,18,19) |
| InChIKey | VHXFKGOAHPACKC-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.10 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |