C9H7BrCl2N2OS — CID 28993502
3-amino-N-(4-bromo-2,6-dichlorophenyl)-3-sulfanylidenepropanamide (PubChem CID 28993502) has the molecular formula C9H7BrCl2N2OS and a molecular weight of 342.05 g/mol. Its IUPAC name is 3-amino-N-(4-bromo-2,6-dichlorophenyl)-3-sulfanylidenepropanamide.
| Compound Name | 3-amino-N-(4-bromo-2,6-dichlorophenyl)-3-sulfanylidenepropanamide |
|---|---|
| PubChem CID | 28993502 |
| Molecular Formula | C9H7BrCl2N2OS |
| Molecular Weight | 342.05 g/mol |
| Exact Mass | 339.88 |
| IUPAC Name | 3-amino-N-(4-bromo-2,6-dichlorophenyl)-3-sulfanylidenepropanamide |
| SMILES | NC(=S)CC(=O)Nc1c(Cl)cc(Br)cc1Cl |
| InChI | InChI=1S/C9H7BrCl2N2OS/c10-4-1-5(11)9(6(12)2-4)14-8(15)3-7(13)16/h1-2H,3H2,(H2,13,16)(H,14,15) |
| InChIKey | NDNMSSDCKYMXRW-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.05 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|