C9H8BrCl2N3O2 — CID 43155915
(3Z)-3-amino-N-(4-bromo-2,6-dichlorophenyl)-3-hydroxyiminopropanamide (PubChem CID 43155915) has the molecular formula C9H8BrCl2N3O2 and a molecular weight of 340.99 g/mol. Its IUPAC name is (3Z)-3-amino-N-(4-bromo-2,6-dichlorophenyl)-3-hydroxyiminopropanamide.
| Compound Name | (3Z)-3-amino-N-(4-bromo-2,6-dichlorophenyl)-3-hydroxyiminopropanamide |
|---|---|
| PubChem CID | 43155915 |
| Molecular Formula | C9H8BrCl2N3O2 |
| Molecular Weight | 340.99 g/mol |
| Exact Mass | 338.92 |
| IUPAC Name | (3Z)-3-amino-N-(4-bromo-2,6-dichlorophenyl)-3-hydroxyiminopropanamide |
| SMILES | N/C(CC(=O)Nc1c(Cl)cc(Br)cc1Cl)=N\O |
| InChI | InChI=1S/C9H8BrCl2N3O2/c10-4-1-5(11)9(6(12)2-4)14-8(16)3-7(13)15-17/h1-2,17H,3H2,(H2,13,15)(H,14,16) |
| InChIKey | LYKMFPKYVZEFTA-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.99 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|