C10H11ClN2OS — CID 28967971
3-amino-N-(2-chloro-4-methylphenyl)-3-sulfanylidenepropanamide (PubChem CID 28967971) has the molecular formula C10H11ClN2OS and a molecular weight of 242.73 g/mol. Its IUPAC name is 3-amino-N-(2-chloro-4-methylphenyl)-3-sulfanylidenepropanamide.
| Compound Name | 3-amino-N-(2-chloro-4-methylphenyl)-3-sulfanylidenepropanamide |
|---|---|
| PubChem CID | 28967971 |
| Molecular Formula | C10H11ClN2OS |
| Molecular Weight | 242.73 g/mol |
| Exact Mass | 242.03 |
| IUPAC Name | 3-amino-N-(2-chloro-4-methylphenyl)-3-sulfanylidenepropanamide |
| SMILES | Cc1ccc(NC(=O)CC(N)=S)c(Cl)c1 |
| InChI | InChI=1S/C10H11ClN2OS/c1-6-2-3-8(7(11)4-6)13-10(14)5-9(12)15/h2-4H,5H2,1H3,(H2,12,15)(H,13,14) |
| InChIKey | PGKVGDDZEPRECW-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.73 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|