C10H13ClN4OS — CID 77060956
[2-(2-chloro-4-methylanilino)-2-oxoethyl] N'-aminocarbamimidothioate (PubChem CID 77060956) has the molecular formula C10H13ClN4OS and a molecular weight of 272.76 g/mol. Its IUPAC name is [2-(2-chloro-4-methylanilino)-2-oxoethyl] N'-aminocarbamimidothioate.
| Compound Name | [2-(2-chloro-4-methylanilino)-2-oxoethyl] N'-aminocarbamimidothioate |
|---|---|
| PubChem CID | 77060956 |
| Molecular Formula | C10H13ClN4OS |
| Molecular Weight | 272.76 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | [2-(2-chloro-4-methylanilino)-2-oxoethyl] N'-aminocarbamimidothioate |
| SMILES | Cc1ccc(NC(=O)CSC(N)=NN)c(Cl)c1 |
| InChI | InChI=1S/C10H13ClN4OS/c1-6-2-3-8(7(11)4-6)14-9(16)5-17-10(12)15-13/h2-4H,5,13H2,1H3,(H2,12,15)(H,14,16) |
| InChIKey | GJNXSPNMXPJESK-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.76 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|