C7H6BrCl2N — CID 23345299
4-bromo-2,6-dichloro-N-methylaniline (PubChem CID 23345299) has the molecular formula C7H6BrCl2N and a molecular weight of 254.94 g/mol. Its IUPAC name is 4-bromo-2,6-dichloro-N-methylaniline.
| Compound Name | 4-bromo-2,6-dichloro-N-methylaniline |
|---|---|
| PubChem CID | 23345299 |
| Molecular Formula | C7H6BrCl2N |
| Molecular Weight | 254.94 g/mol |
| Exact Mass | 252.91 |
| IUPAC Name | 4-bromo-2,6-dichloro-N-methylaniline |
| SMILES | CNc1c(Cl)cc(Br)cc1Cl |
| InChI | InChI=1S/C7H6BrCl2N/c1-11-7-5(9)2-4(8)3-6(7)10/h2-3,11H,1H3 |
| InChIKey | UPPRTGPCOAJSFT-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.94 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |