C8H6BrCl2NO — CID 170992492
4-bromo-2,6-dichloro-N-methylbenzamide (PubChem CID 170992492) has the molecular formula C8H6BrCl2NO and a molecular weight of 282.95 g/mol. Its IUPAC name is 4-bromo-2,6-dichloro-N-methylbenzamide.
| Compound Name | 4-bromo-2,6-dichloro-N-methylbenzamide |
|---|---|
| PubChem CID | 170992492 |
| Molecular Formula | C8H6BrCl2NO |
| Molecular Weight | 282.95 g/mol |
| Exact Mass | 280.90 |
| IUPAC Name | 4-bromo-2,6-dichloro-N-methylbenzamide |
| SMILES | CNC(=O)c1c(Cl)cc(Br)cc1Cl |
| InChI | InChI=1S/C8H6BrCl2NO/c1-12-8(13)7-5(10)2-4(9)3-6(7)11/h2-3H,1H3,(H,12,13) |
| InChIKey | SXBRAYFVGUDKGB-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.95 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |