C17H15BrClFN2O5S — CID 155569544
5-[(5-bromo-3-chloro-2-hydroxyphenyl)sulfonylamino]-3-cyclopropyl-2-fluoro-6-hydroxy-N-methylbenzamide (PubChem CID 155569544) has the molecular formula C17H15BrClFN2O5S and a molecular weight of 493.74 g/mol. Its IUPAC name is 5-[(5-bromo-3-chloro-2-hydroxyphenyl)sulfonylamino]-3-cyclopropyl-2-fluoro-6-hydroxy-N-methylbenzamide.
| Compound Name | 5-[(5-bromo-3-chloro-2-hydroxyphenyl)sulfonylamino]-3-cyclopropyl-2-fluoro-6-hydroxy-N-methylbenzamide |
|---|---|
| PubChem CID | 155569544 |
| Molecular Formula | C17H15BrClFN2O5S |
| Molecular Weight | 493.74 g/mol |
| Exact Mass | 491.96 |
| IUPAC Name | 5-[(5-bromo-3-chloro-2-hydroxyphenyl)sulfonylamino]-3-cyclopropyl-2-fluoro-6-hydroxy-N-methylbenzamide |
| SMILES | CNC(=O)c1c(O)c(NS(=O)(=O)c2cc(Br)cc(Cl)c2O)cc(C2CC2)c1F |
| InChI | InChI=1S/C17H15BrClFN2O5S/c1-21-17(25)13-14(20)9(7-2-3-7)6-11(16(13)24)22-28(26,27)12-5-8(18)4-10(19)15(12)23/h4-7,22-24H,2-3H2,1H3,(H,21,25) |
| InChIKey | YVPZGFQMOJVHEN-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.74 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfonamide_A(43)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|