C19H23BrCl2N4O6S2 — CID 165153365
3-[(5-bromo-3-chloro-2-hydroxyphenyl)sulfonylamino]-5-chloro-2-hydroxy-N-[2-(4-methylpiperazin-1-yl)ethyl]benzenesulfonamide (PubChem CID 165153365) has the molecular formula C19H23BrCl2N4O6S2 and a molecular weight of 618.36 g/mol. Its IUPAC name is 3-[(5-bromo-3-chloro-2-hydroxyphenyl)sulfonylamino]-5-chloro-2-hydroxy-N-[2-(4-methylpiperazin-1-yl)ethyl]benzenesulfonamide.
| Compound Name | 3-[(5-bromo-3-chloro-2-hydroxyphenyl)sulfonylamino]-5-chloro-2-hydroxy-N-[2-(4-methylpiperazin-1-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 165153365 |
| Molecular Formula | C19H23BrCl2N4O6S2 |
| Molecular Weight | 618.36 g/mol |
| Exact Mass | 615.96 |
| IUPAC Name | 3-[(5-bromo-3-chloro-2-hydroxyphenyl)sulfonylamino]-5-chloro-2-hydroxy-N-[2-(4-methylpiperazin-1-yl)ethyl]benzenesulfonamide |
| SMILES | CN1CCN(CCNS(=O)(=O)c2cc(Cl)cc(NS(=O)(=O)c3cc(Br)cc(Cl)c3O)c2O)CC1 |
| InChI | InChI=1S/C19H23BrCl2N4O6S2/c1-25-4-6-26(7-5-25)3-2-23-33(29,30)17-11-13(21)10-15(19(17)28)24-34(31,32)16-9-12(20)8-14(22)18(16)27/h8-11,23-24,27-28H,2-7H2,1H3 |
| InChIKey | OJAXVSKZPGXKBC-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 139.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.36 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfonamide_A(43)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|