C14H21BrClN3O3S — CID 112812715
3-bromo-5-chloro-2-methoxy-N-[2-(4-methylpiperazin-1-yl)ethyl]benzenesulfonamide (PubChem CID 112812715) has the molecular formula C14H21BrClN3O3S and a molecular weight of 426.76 g/mol. Its IUPAC name is 3-bromo-5-chloro-2-methoxy-N-[2-(4-methylpiperazin-1-yl)ethyl]benzenesulfonamide.
| Compound Name | 3-bromo-5-chloro-2-methoxy-N-[2-(4-methylpiperazin-1-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 112812715 |
| Molecular Formula | C14H21BrClN3O3S |
| Molecular Weight | 426.76 g/mol |
| Exact Mass | 425.02 |
| IUPAC Name | 3-bromo-5-chloro-2-methoxy-N-[2-(4-methylpiperazin-1-yl)ethyl]benzenesulfonamide |
| SMILES | COc1c(Br)cc(Cl)cc1S(=O)(=O)NCCN1CCN(C)CC1 |
| InChI | InChI=1S/C14H21BrClN3O3S/c1-18-5-7-19(8-6-18)4-3-17-23(20,21)13-10-11(16)9-12(15)14(13)22-2/h9-10,17H,3-8H2,1-2H3 |
| InChIKey | IMYOZJLOCHZNFC-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.76 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |