C12H5Cl6NO3S — CID 22763232
3,5-dichloro-2-hydroxy-N-(2,3,4,5-tetrachlorophenyl)benzenesulfonamide (PubChem CID 22763232) has the molecular formula C12H5Cl6NO3S and a molecular weight of 455.96 g/mol. Its IUPAC name is 3,5-dichloro-2-hydroxy-N-(2,3,4,5-tetrachlorophenyl)benzenesulfonamide.
| Compound Name | 3,5-dichloro-2-hydroxy-N-(2,3,4,5-tetrachlorophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 22763232 |
| Molecular Formula | C12H5Cl6NO3S |
| Molecular Weight | 455.96 g/mol |
| Exact Mass | 452.81 |
| IUPAC Name | 3,5-dichloro-2-hydroxy-N-(2,3,4,5-tetrachlorophenyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cc(Cl)c(Cl)c(Cl)c1Cl)c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C12H5Cl6NO3S/c13-4-1-6(15)12(20)8(2-4)23(21,22)19-7-3-5(14)9(16)11(18)10(7)17/h1-3,19-20H |
| InChIKey | WABIWPLBVREHOQ-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.96 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfonamide_A(43)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|