C12H4Cl7NO3S — CID 22763219
2,3,4,5-tetrachloro-6-hydroxy-N-(2,3,5-trichlorophenyl)benzenesulfonamide (PubChem CID 22763219) has the molecular formula C12H4Cl7NO3S and a molecular weight of 490.41 g/mol. Its IUPAC name is 2,3,4,5-tetrachloro-6-hydroxy-N-(2,3,5-trichlorophenyl)benzenesulfonamide.
| Compound Name | 2,3,4,5-tetrachloro-6-hydroxy-N-(2,3,5-trichlorophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 22763219 |
| Molecular Formula | C12H4Cl7NO3S |
| Molecular Weight | 490.41 g/mol |
| Exact Mass | 486.77 |
| IUPAC Name | 2,3,4,5-tetrachloro-6-hydroxy-N-(2,3,5-trichlorophenyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cc(Cl)cc(Cl)c1Cl)c1c(O)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C12H4Cl7NO3S/c13-3-1-4(14)6(15)5(2-3)20-24(22,23)12-10(19)8(17)7(16)9(18)11(12)21/h1-2,20-21H |
| InChIKey | GYDDBFJJDFJOOW-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.41 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|