C26H12Cl10N2O6 — CID 21431939
2,3,5-trichloro-N-(3,5-dichloro-2-hydroxyphenyl)-6-hydroxybenzamide (PubChem CID 21431939) has the molecular formula C26H12Cl10N2O6 and a molecular weight of 802.92 g/mol. Its IUPAC name is 2,3,5-trichloro-N-(3,5-dichloro-2-hydroxyphenyl)-6-hydroxybenzamide.
| Compound Name | 2,3,5-trichloro-N-(3,5-dichloro-2-hydroxyphenyl)-6-hydroxybenzamide |
|---|---|
| PubChem CID | 21431939 |
| Molecular Formula | C26H12Cl10N2O6 |
| Molecular Weight | 802.92 g/mol |
| Exact Mass | 797.76 |
| IUPAC Name | 2,3,5-trichloro-N-(3,5-dichloro-2-hydroxyphenyl)-6-hydroxybenzamide |
| SMILES | O=C(Nc1cc(Cl)cc(Cl)c1O)c1c(O)c(Cl)cc(Cl)c1Cl.O=C(Nc1cc(Cl)cc(Cl)c1O)c1c(O)c(Cl)cc(Cl)c1Cl |
| InChI | InChI=1S/2C13H6Cl5NO3/c2*14-4-1-6(16)11(20)8(2-4)19-13(22)9-10(18)5(15)3-7(17)12(9)21/h2*1-3,20-21H,(H,19,22) |
| InChIKey | KDQSPSZZANPKJW-UHFFFAOYSA-N |
| XLogP | 11.23 |
| TPSA | 139.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.92 |
| LogP ≤ 5 | 11.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|