C11H9Cl2NO4 — CID 113434383
N-(3,5-dichloro-2-hydroxyphenyl)-2,3-dihydro-1,4-dioxine-5-carboxamide (PubChem CID 113434383) has the molecular formula C11H9Cl2NO4 and a molecular weight of 290.10 g/mol. Its IUPAC name is N-(3,5-dichloro-2-hydroxyphenyl)-2,3-dihydro-1,4-dioxine-5-carboxamide.
| Compound Name | N-(3,5-dichloro-2-hydroxyphenyl)-2,3-dihydro-1,4-dioxine-5-carboxamide |
|---|---|
| PubChem CID | 113434383 |
| Molecular Formula | C11H9Cl2NO4 |
| Molecular Weight | 290.10 g/mol |
| Exact Mass | 288.99 |
| IUPAC Name | N-(3,5-dichloro-2-hydroxyphenyl)-2,3-dihydro-1,4-dioxine-5-carboxamide |
| SMILES | O=C(Nc1cc(Cl)cc(Cl)c1O)C1=COCCO1 |
| InChI | InChI=1S/C11H9Cl2NO4/c12-6-3-7(13)10(15)8(4-6)14-11(16)9-5-17-1-2-18-9/h3-5,15H,1-2H2,(H,14,16) |
| InChIKey | AYCSPULNPXHMPS-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.10 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|