C15H12Cl3NO2 — CID 23729699
2,3,5-trichloro-N-(3,5-dimethylphenyl)-6-hydroxybenzamide (PubChem CID 23729699) has the molecular formula C15H12Cl3NO2 and a molecular weight of 344.63 g/mol. Its IUPAC name is 2,3,5-trichloro-N-(3,5-dimethylphenyl)-6-hydroxybenzamide.
| Compound Name | 2,3,5-trichloro-N-(3,5-dimethylphenyl)-6-hydroxybenzamide |
|---|---|
| PubChem CID | 23729699 |
| Molecular Formula | C15H12Cl3NO2 |
| Molecular Weight | 344.63 g/mol |
| Exact Mass | 342.99 |
| IUPAC Name | 2,3,5-trichloro-N-(3,5-dimethylphenyl)-6-hydroxybenzamide |
| SMILES | Cc1cc(C)cc(NC(=O)c2c(O)c(Cl)cc(Cl)c2Cl)c1 |
| InChI | InChI=1S/C15H12Cl3NO2/c1-7-3-8(2)5-9(4-7)19-15(21)12-13(18)10(16)6-11(17)14(12)20/h3-6,20H,1-2H3,(H,19,21) |
| InChIKey | SZXRZQQHMPRJNE-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.63 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|