C21H14Cl3FN2O4 — CID 112827442
2,3,5-trichloro-N-[3-[(3-fluorobenzoyl)amino]-4-methoxyphenyl]-6-hydroxybenzamide (PubChem CID 112827442) has the molecular formula C21H14Cl3FN2O4 and a molecular weight of 483.71 g/mol. Its IUPAC name is 2,3,5-trichloro-N-[3-[(3-fluorobenzoyl)amino]-4-methoxyphenyl]-6-hydroxybenzamide.
| Compound Name | 2,3,5-trichloro-N-[3-[(3-fluorobenzoyl)amino]-4-methoxyphenyl]-6-hydroxybenzamide |
|---|---|
| PubChem CID | 112827442 |
| Molecular Formula | C21H14Cl3FN2O4 |
| Molecular Weight | 483.71 g/mol |
| Exact Mass | 482.00 |
| IUPAC Name | 2,3,5-trichloro-N-[3-[(3-fluorobenzoyl)amino]-4-methoxyphenyl]-6-hydroxybenzamide |
| SMILES | COc1ccc(NC(=O)c2c(O)c(Cl)cc(Cl)c2Cl)cc1NC(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C21H14Cl3FN2O4/c1-31-16-6-5-12(8-15(16)27-20(29)10-3-2-4-11(25)7-10)26-21(30)17-18(24)13(22)9-14(23)19(17)28/h2-9,28H,1H3,(H,26,30)(H,27,29) |
| InChIKey | WASSHGVDZVPKCC-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.71 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|