C25H21FN4O3 — CID 55779610
N-[3-[(3-fluorobenzoyl)amino]-4-methoxyphenyl]-5-methyl-1-phenylpyrazole-3-carboxamide (PubChem CID 55779610) has the molecular formula C25H21FN4O3 and a molecular weight of 444.47 g/mol. Its IUPAC name is N-[3-[(3-fluorobenzoyl)amino]-4-methoxyphenyl]-5-methyl-1-phenylpyrazole-3-carboxamide.
| Compound Name | N-[3-[(3-fluorobenzoyl)amino]-4-methoxyphenyl]-5-methyl-1-phenylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 55779610 |
| Molecular Formula | C25H21FN4O3 |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | N-[3-[(3-fluorobenzoyl)amino]-4-methoxyphenyl]-5-methyl-1-phenylpyrazole-3-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cc(C)n(-c3ccccc3)n2)cc1NC(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C25H21FN4O3/c1-16-13-22(29-30(16)20-9-4-3-5-10-20)25(32)27-19-11-12-23(33-2)21(15-19)28-24(31)17-7-6-8-18(26)14-17/h3-15H,1-2H3,(H,27,32)(H,28,31) |
| InChIKey | VZDKBCGPVWDZIX-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |