C24H18F2N4O3 — CID 55725884
N-[3-[(3-fluorobenzoyl)amino]-4-methoxyphenyl]-3-(4-fluorophenyl)imidazole-4-carboxamide (PubChem CID 55725884) has the molecular formula C24H18F2N4O3 and a molecular weight of 448.43 g/mol. Its IUPAC name is N-[3-[(3-fluorobenzoyl)amino]-4-methoxyphenyl]-3-(4-fluorophenyl)imidazole-4-carboxamide.
| Compound Name | N-[3-[(3-fluorobenzoyl)amino]-4-methoxyphenyl]-3-(4-fluorophenyl)imidazole-4-carboxamide |
|---|---|
| PubChem CID | 55725884 |
| Molecular Formula | C24H18F2N4O3 |
| Molecular Weight | 448.43 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | N-[3-[(3-fluorobenzoyl)amino]-4-methoxyphenyl]-3-(4-fluorophenyl)imidazole-4-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cncn2-c2ccc(F)cc2)cc1NC(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C24H18F2N4O3/c1-33-22-10-7-18(12-20(22)29-23(31)15-3-2-4-17(26)11-15)28-24(32)21-13-27-14-30(21)19-8-5-16(25)6-9-19/h2-14H,1H3,(H,28,32)(H,29,31) |
| InChIKey | RMFSTYIDHAHWMH-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.43 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |