C13H7BrCl2FNO2 — CID 103891179
2-bromo-N-(3,5-dichloro-2-hydroxyphenyl)-6-fluorobenzamide (PubChem CID 103891179) has the molecular formula C13H7BrCl2FNO2 and a molecular weight of 379.01 g/mol. Its IUPAC name is 2-bromo-N-(3,5-dichloro-2-hydroxyphenyl)-6-fluorobenzamide.
| Compound Name | 2-bromo-N-(3,5-dichloro-2-hydroxyphenyl)-6-fluorobenzamide |
|---|---|
| PubChem CID | 103891179 |
| Molecular Formula | C13H7BrCl2FNO2 |
| Molecular Weight | 379.01 g/mol |
| Exact Mass | 376.90 |
| IUPAC Name | 2-bromo-N-(3,5-dichloro-2-hydroxyphenyl)-6-fluorobenzamide |
| SMILES | O=C(Nc1cc(Cl)cc(Cl)c1O)c1c(F)cccc1Br |
| InChI | InChI=1S/C13H7BrCl2FNO2/c14-7-2-1-3-9(17)11(7)13(20)18-10-5-6(15)4-8(16)12(10)19/h1-5,19H,(H,18,20) |
| InChIKey | CNNYTDDQIBLRIP-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.01 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|