C13H9BrCl2N2O2 — CID 21184650
1-(2-bromophenyl)-3-(3,5-dichloro-2-hydroxyphenyl)urea (PubChem CID 21184650) has the molecular formula C13H9BrCl2N2O2 and a molecular weight of 376.04 g/mol. Its IUPAC name is 1-(2-bromophenyl)-3-(3,5-dichloro-2-hydroxyphenyl)urea.
| Compound Name | 1-(2-bromophenyl)-3-(3,5-dichloro-2-hydroxyphenyl)urea |
|---|---|
| PubChem CID | 21184650 |
| Molecular Formula | C13H9BrCl2N2O2 |
| Molecular Weight | 376.04 g/mol |
| Exact Mass | 373.92 |
| IUPAC Name | 1-(2-bromophenyl)-3-(3,5-dichloro-2-hydroxyphenyl)urea |
| SMILES | O=C(Nc1ccccc1Br)Nc1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C13H9BrCl2N2O2/c14-8-3-1-2-4-10(8)17-13(20)18-11-6-7(15)5-9(16)12(11)19/h1-6,19H,(H2,17,18,20) |
| InChIKey | XCDHYNNOCDUAGE-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.04 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|