C13H9BrCl2N2O — CID 108868832
1-(2-bromophenyl)-3-(2,6-dichlorophenyl)urea (PubChem CID 108868832) has the molecular formula C13H9BrCl2N2O and a molecular weight of 360.04 g/mol. Its IUPAC name is 1-(2-bromophenyl)-3-(2,6-dichlorophenyl)urea.
| Compound Name | 1-(2-bromophenyl)-3-(2,6-dichlorophenyl)urea |
|---|---|
| PubChem CID | 108868832 |
| Molecular Formula | C13H9BrCl2N2O |
| Molecular Weight | 360.04 g/mol |
| Exact Mass | 357.93 |
| IUPAC Name | 1-(2-bromophenyl)-3-(2,6-dichlorophenyl)urea |
| SMILES | O=C(Nc1ccccc1Br)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C13H9BrCl2N2O/c14-8-4-1-2-7-11(8)17-13(19)18-12-9(15)5-3-6-10(12)16/h1-7H,(H2,17,18,19) |
| InChIKey | RNRQVUBEGKTJPL-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.04 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |