C15H12BrClN2O3 — CID 23512395
2-[4-[(2-bromophenyl)carbamoylamino]-3-chlorophenyl]acetic acid (PubChem CID 23512395) has the molecular formula C15H12BrClN2O3 and a molecular weight of 383.63 g/mol. Its IUPAC name is 2-[4-[(2-bromophenyl)carbamoylamino]-3-chlorophenyl]acetic acid.
| Compound Name | 2-[4-[(2-bromophenyl)carbamoylamino]-3-chlorophenyl]acetic acid |
|---|---|
| PubChem CID | 23512395 |
| Molecular Formula | C15H12BrClN2O3 |
| Molecular Weight | 383.63 g/mol |
| Exact Mass | 381.97 |
| IUPAC Name | 2-[4-[(2-bromophenyl)carbamoylamino]-3-chlorophenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(NC(=O)Nc2ccccc2Br)c(Cl)c1 |
| InChI | InChI=1S/C15H12BrClN2O3/c16-10-3-1-2-4-12(10)18-15(22)19-13-6-5-9(7-11(13)17)8-14(20)21/h1-7H,8H2,(H,20,21)(H2,18,19,22) |
| InChIKey | AIWVWUURMDQTIJ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.63 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |