C14H14BrCl2N3O2 — CID 45263183
1-[3-(aminomethyl)-4-chloro-2-hydroxyphenyl]-3-(2-bromophenyl)urea;hydrochloride (PubChem CID 45263183) has the molecular formula C14H14BrCl2N3O2 and a molecular weight of 407.10 g/mol. Its IUPAC name is 1-[3-(aminomethyl)-4-chloro-2-hydroxyphenyl]-3-(2-bromophenyl)urea;hydrochloride.
| Compound Name | 1-[3-(aminomethyl)-4-chloro-2-hydroxyphenyl]-3-(2-bromophenyl)urea;hydrochloride |
|---|---|
| PubChem CID | 45263183 |
| Molecular Formula | C14H14BrCl2N3O2 |
| Molecular Weight | 407.10 g/mol |
| Exact Mass | 404.96 |
| IUPAC Name | 1-[3-(aminomethyl)-4-chloro-2-hydroxyphenyl]-3-(2-bromophenyl)urea;hydrochloride |
| SMILES | Cl.NCc1c(Cl)ccc(NC(=O)Nc2ccccc2Br)c1O |
| InChI | InChI=1S/C14H13BrClN3O2.ClH/c15-9-3-1-2-4-11(9)18-14(21)19-12-6-5-10(16)8(7-17)13(12)20;/h1-6,20H,7,17H2,(H2,18,19,21);1H |
| InChIKey | RRTPXQMDDQMPQL-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.10 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|