C18H21BrClN3O5S — CID 18373493
1-(2-bromophenyl)-3-[4-chloro-2-hydroxy-3-(2-propan-2-yloxyethylsulfamoyl)phenyl]urea (PubChem CID 18373493) has the molecular formula C18H21BrClN3O5S and a molecular weight of 506.81 g/mol. Its IUPAC name is 1-(2-bromophenyl)-3-[4-chloro-2-hydroxy-3-(2-propan-2-yloxyethylsulfamoyl)phenyl]urea.
| Compound Name | 1-(2-bromophenyl)-3-[4-chloro-2-hydroxy-3-(2-propan-2-yloxyethylsulfamoyl)phenyl]urea |
|---|---|
| PubChem CID | 18373493 |
| Molecular Formula | C18H21BrClN3O5S |
| Molecular Weight | 506.81 g/mol |
| Exact Mass | 505.01 |
| IUPAC Name | 1-(2-bromophenyl)-3-[4-chloro-2-hydroxy-3-(2-propan-2-yloxyethylsulfamoyl)phenyl]urea |
| SMILES | CC(C)OCCNS(=O)(=O)c1c(Cl)ccc(NC(=O)Nc2ccccc2Br)c1O |
| InChI | InChI=1S/C18H21BrClN3O5S/c1-11(2)28-10-9-21-29(26,27)17-13(20)7-8-15(16(17)24)23-18(25)22-14-6-4-3-5-12(14)19/h3-8,11,21,24H,9-10H2,1-2H3,(H2,22,23,25) |
| InChIKey | XTMOHOUEIHSHBP-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.81 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|