C13H11BrClN3O4S — CID 70154985
1-(3-bromophenyl)-3-(4-chloro-2-hydroxy-3-sulfamoylphenyl)urea (PubChem CID 70154985) has the molecular formula C13H11BrClN3O4S and a molecular weight of 420.67 g/mol. Its IUPAC name is 1-(3-bromophenyl)-3-(4-chloro-2-hydroxy-3-sulfamoylphenyl)urea.
| Compound Name | 1-(3-bromophenyl)-3-(4-chloro-2-hydroxy-3-sulfamoylphenyl)urea |
|---|---|
| PubChem CID | 70154985 |
| Molecular Formula | C13H11BrClN3O4S |
| Molecular Weight | 420.67 g/mol |
| Exact Mass | 418.93 |
| IUPAC Name | 1-(3-bromophenyl)-3-(4-chloro-2-hydroxy-3-sulfamoylphenyl)urea |
| SMILES | NS(=O)(=O)c1c(Cl)ccc(NC(=O)Nc2cccc(Br)c2)c1O |
| InChI | InChI=1S/C13H11BrClN3O4S/c14-7-2-1-3-8(6-7)17-13(20)18-10-5-4-9(15)12(11(10)19)23(16,21)22/h1-6,19H,(H2,16,21,22)(H2,17,18,20) |
| InChIKey | WQEDVLYGVSEMLU-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.67 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|