C13H9BrF2N2O — CID 3468982
1-(3-bromophenyl)-3-(2,5-difluorophenyl)urea (PubChem CID 3468982) has the molecular formula C13H9BrF2N2O and a molecular weight of 327.13 g/mol. Its IUPAC name is 1-(3-bromophenyl)-3-(2,5-difluorophenyl)urea.
| Compound Name | 1-(3-bromophenyl)-3-(2,5-difluorophenyl)urea |
|---|---|
| PubChem CID | 3468982 |
| Molecular Formula | C13H9BrF2N2O |
| Molecular Weight | 327.13 g/mol |
| Exact Mass | 325.99 |
| IUPAC Name | 1-(3-bromophenyl)-3-(2,5-difluorophenyl)urea |
| SMILES | O=C(Nc1cccc(Br)c1)Nc1cc(F)ccc1F |
| InChI | InChI=1S/C13H9BrF2N2O/c14-8-2-1-3-10(6-8)17-13(19)18-12-7-9(15)4-5-11(12)16/h1-7H,(H2,17,18,19) |
| InChIKey | ISOBVRGBHXVHNF-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.13 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |