C14H12BrFN2O2 — CID 156854728
1-(3-bromophenyl)-3-[3-fluoro-2-(hydroxymethyl)phenyl]urea (PubChem CID 156854728) has the molecular formula C14H12BrFN2O2 and a molecular weight of 339.16 g/mol. Its IUPAC name is 1-(3-bromophenyl)-3-[3-fluoro-2-(hydroxymethyl)phenyl]urea.
| Compound Name | 1-(3-bromophenyl)-3-[3-fluoro-2-(hydroxymethyl)phenyl]urea |
|---|---|
| PubChem CID | 156854728 |
| Molecular Formula | C14H12BrFN2O2 |
| Molecular Weight | 339.16 g/mol |
| Exact Mass | 338.01 |
| IUPAC Name | 1-(3-bromophenyl)-3-[3-fluoro-2-(hydroxymethyl)phenyl]urea |
| SMILES | O=C(Nc1cccc(Br)c1)Nc1cccc(F)c1CO |
| InChI | InChI=1S/C14H12BrFN2O2/c15-9-3-1-4-10(7-9)17-14(20)18-13-6-2-5-12(16)11(13)8-19/h1-7,19H,8H2,(H2,17,18,20) |
| InChIKey | DODNIQTWDATJFC-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.16 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |